C23H34N6O6 — CID 173254046
pentyl 3-[[(3S)-1-[4-[N'-(dimethylcarbamoyloxy)carbamimidoyl]phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate (PubChem CID 173254046) has the molecular formula C23H34N6O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is pentyl 3-[[(3S)-1-[4-[N'-(dimethylcarbamoyloxy)carbamimidoyl]phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate.
| Compound Name | pentyl 3-[[(3S)-1-[4-[N'-(dimethylcarbamoyloxy)carbamimidoyl]phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 173254046 |
| Molecular Formula | C23H34N6O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | pentyl 3-[[(3S)-1-[4-[N'-(dimethylcarbamoyloxy)carbamimidoyl]phenyl]-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate |
| SMILES | CCCCCOC(=O)CCNC(=O)N[C@H]1CCN(c2ccc(C(N)=NOC(=O)N(C)C)cc2)C1=O |
| InChI | InChI=1S/C23H34N6O6/c1-4-5-6-15-34-19(30)11-13-25-22(32)26-18-12-14-29(21(18)31)17-9-7-16(8-10-17)20(24)27-35-23(33)28(2)3/h7-10,18H,4-6,11-15H2,1-3H3,(H2,24,27)(H2,25,26,32)/t18-/m0/s1 |
| InChIKey | KFPMXVNTQFXICY-SFHVURJKSA-N |
| XLogP | 1.53 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|