About ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol
ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol (PubChem CID 159678359) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol |
| PubChem CID | 159678359 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol |
| SMILES | CCOC=O.Cc1nccnc1CCCO |
| InChI | InChI=1S/C8H12N2O.C3H6O2/c1-7-8(3-2-6-11)10-5-4-9-7;1-2-5-3-4/h4-5,11H,2-3,6H2,1H3;3H,2H2,1H3 |
| InChIKey | MUXACAFCJXZVAT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol?
The IUPAC name of ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol (CID 159678359) is ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol.
What is the SMILES notation for ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol?
The canonical SMILES for ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol is CCOC=O.Cc1nccnc1CCCO.
What is the InChIKey of ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol?
The InChIKey is MUXACAFCJXZVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O.C3H6O2/c1-7-8(3-2-6-11)10-5-4-9-7;1-2-5-3-4/h4-5,11H,2-3,6H2,1H3;3H,2H2,1H3.
What are the key properties of ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol?
ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol has a molecular weight of 226.28 g/mol, XLogP of 0.89, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;3-(3-methylpyrazin-2-yl)propan-1-ol is sourced from PubChem (CID 159678359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).