C16H13BrN2O2 — CID 159678407
6-bromo-N-(2-hydroxy-3-methylphenyl)-1H-indole-2-carboxamide (PubChem CID 159678407) has the molecular formula C16H13BrN2O2 and a molecular weight of 345.20 g/mol. Its IUPAC name is 6-bromo-N-(2-hydroxy-3-methylphenyl)-1H-indole-2-carboxamide.
| Compound Name | 6-bromo-N-(2-hydroxy-3-methylphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 159678407 |
| Molecular Formula | C16H13BrN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 6-bromo-N-(2-hydroxy-3-methylphenyl)-1H-indole-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc3ccc(Br)cc3[nH]2)c1O |
| InChI | InChI=1S/C16H13BrN2O2/c1-9-3-2-4-12(15(9)20)19-16(21)14-7-10-5-6-11(17)8-13(10)18-14/h2-8,18,20H,1H3,(H,19,21) |
| InChIKey | HPGUWVIUTSABMP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|