C17H14BrN3O3 — CID 157439113
6-bromo-N-(4,5-dimethyl-2-nitrophenyl)-1H-indole-2-carboxamide (PubChem CID 157439113) has the molecular formula C17H14BrN3O3 and a molecular weight of 388.22 g/mol. Its IUPAC name is 6-bromo-N-(4,5-dimethyl-2-nitrophenyl)-1H-indole-2-carboxamide.
| Compound Name | 6-bromo-N-(4,5-dimethyl-2-nitrophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 157439113 |
| Molecular Formula | C17H14BrN3O3 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 6-bromo-N-(4,5-dimethyl-2-nitrophenyl)-1H-indole-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc3ccc(Br)cc3[nH]2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C17H14BrN3O3/c1-9-5-14(16(21(23)24)6-10(9)2)20-17(22)15-7-11-3-4-12(18)8-13(11)19-15/h3-8,19H,1-2H3,(H,20,22) |
| InChIKey | BRLNFAJJCDPCRP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|