C13H25NO2 — CID 159679280
2-cyclohexyl-N-propan-2-yl-1,4-dioxan-2-amine (PubChem CID 159679280) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-cyclohexyl-N-propan-2-yl-1,4-dioxan-2-amine.
| Compound Name | 2-cyclohexyl-N-propan-2-yl-1,4-dioxan-2-amine |
|---|---|
| PubChem CID | 159679280 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2-cyclohexyl-N-propan-2-yl-1,4-dioxan-2-amine |
| SMILES | CC(C)NC1(C2CCCCC2)COCCO1 |
| InChI | InChI=1S/C13H25NO2/c1-11(2)14-13(10-15-8-9-16-13)12-6-4-3-5-7-12/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | MUZXRKWOYIRBPN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |