C22H36N4O14 — CID 159682108
2-[[2-[7-[2-(dicarboxymethylamino)-2-oxoethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-6-yl]acetyl]amino]propanedioic acid (PubChem CID 159682108) has the molecular formula C22H36N4O14 and a molecular weight of 580.54 g/mol. Its IUPAC name is 2-[[2-[7-[2-(dicarboxymethylamino)-2-oxoethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-6-yl]acetyl]amino]propanedioic acid.
| Compound Name | 2-[[2-[7-[2-(dicarboxymethylamino)-2-oxoethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-6-yl]acetyl]amino]propanedioic acid |
|---|---|
| PubChem CID | 159682108 |
| Molecular Formula | C22H36N4O14 |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | 2-[[2-[7-[2-(dicarboxymethylamino)-2-oxoethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-6-yl]acetyl]amino]propanedioic acid |
| SMILES | O=C(CC1COCCOCCNCCOCCOCCN1CC(=O)NC(C(=O)O)C(=O)O)NC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H36N4O14/c27-15(24-17(19(29)30)20(31)32)11-14-13-40-10-9-38-5-2-23-1-4-37-7-8-39-6-3-26(14)12-16(28)25-18(21(33)34)22(35)36/h14,17-18,23H,1-13H2,(H,24,27)(H,25,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | LKLZBJIBRXYLPU-UHFFFAOYSA-N |
| XLogP | -3.98 |
| TPSA | 259.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|