C27H35N5O8S — CID 175716702
6-[[(6S)-6-[(6-carboxy-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-isothiocyanatopyridine-2-carboxylic acid (PubChem CID 175716702) has the molecular formula C27H35N5O8S and a molecular weight of 589.67 g/mol. Its IUPAC name is 6-[[(6S)-6-[(6-carboxy-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-isothiocyanatopyridine-2-carboxylic acid.
| Compound Name | 6-[[(6S)-6-[(6-carboxy-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-isothiocyanatopyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 175716702 |
| Molecular Formula | C27H35N5O8S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 6-[[(6S)-6-[(6-carboxy-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-isothiocyanatopyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(C[C@H]2COCCOCCNCCOCCOCCN2Cc2cc(N=C=S)cc(C(=O)O)n2)n1 |
| InChI | InChI=1S/C27H35N5O8S/c33-26(34)24-3-1-2-20(30-24)15-23-18-40-13-12-38-8-5-28-4-7-37-10-11-39-9-6-32(23)17-22-14-21(29-19-41)16-25(31-22)27(35)36/h1-3,14,16,23,28H,4-13,15,17-18H2,(H,33,34)(H,35,36)/t23-/m0/s1 |
| InChIKey | SIASZUMCYQALTC-QHCPKHFHSA-N |
| XLogP | 1.69 |
| TPSA | 164.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|