About 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide
6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide (PubChem CID 95840701) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide |
| PubChem CID | 95840701 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cccc(C[C@@H]2CNCCOC2)n1 |
| InChI | InChI=1S/C12H17N3O2/c13-12(16)11-3-1-2-10(15-11)6-9-7-14-4-5-17-8-9/h1-3,9,14H,4-8H2,(H2,13,16)/t9-/m1/s1 |
| InChIKey | KKZWZDAZLMARPF-SECBINFHSA-N |
| XLogP | -0.04 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide?
The IUPAC name of 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide (CID 95840701) is 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide.
What is the SMILES notation for 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide?
The canonical SMILES for 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide is NC(=O)c1cccc(C[C@@H]2CNCCOC2)n1.
What is the InChIKey of 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide?
The InChIKey is KKZWZDAZLMARPF-SECBINFHSA-N. The full InChI is InChI=1S/C12H17N3O2/c13-12(16)11-3-1-2-10(15-11)6-9-7-14-4-5-17-8-9/h1-3,9,14H,4-8H2,(H2,13,16)/t9-/m1/s1.
What are the key properties of 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide?
6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide has a molecular weight of 235.29 g/mol, XLogP of -0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(6R)-1,4-oxazepan-6-yl]methyl]pyridine-2-carboxamide is sourced from PubChem (CID 95840701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).