C13H18ClN3O2 — CID 56885160
1-(2-chlorophenyl)-3-(1,4-oxazepan-6-ylmethyl)urea (PubChem CID 56885160) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(1,4-oxazepan-6-ylmethyl)urea.
| Compound Name | 1-(2-chlorophenyl)-3-(1,4-oxazepan-6-ylmethyl)urea |
|---|---|
| PubChem CID | 56885160 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(1,4-oxazepan-6-ylmethyl)urea |
| SMILES | O=C(NCC1CNCCOC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C13H18ClN3O2/c14-11-3-1-2-4-12(11)17-13(18)16-8-10-7-15-5-6-19-9-10/h1-4,10,15H,5-9H2,(H2,16,17,18) |
| InChIKey | JBHOFGGNNHXAFQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |