C14H18Cl2N2O2 — CID 97193785
3,5-dichloro-4-methyl-N-[[(6R)-1,4-oxazepan-6-yl]methyl]benzamide (PubChem CID 97193785) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 3,5-dichloro-4-methyl-N-[[(6R)-1,4-oxazepan-6-yl]methyl]benzamide.
| Compound Name | 3,5-dichloro-4-methyl-N-[[(6R)-1,4-oxazepan-6-yl]methyl]benzamide |
|---|---|
| PubChem CID | 97193785 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3,5-dichloro-4-methyl-N-[[(6R)-1,4-oxazepan-6-yl]methyl]benzamide |
| SMILES | Cc1c(Cl)cc(C(=O)NC[C@H]2CNCCOC2)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-9-12(15)4-11(5-13(9)16)14(19)18-7-10-6-17-2-3-20-8-10/h4-5,10,17H,2-3,6-8H2,1H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | KVIMAAFYODOJMM-SNVBAGLBSA-N |
| XLogP | 2.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |