C17H22N2O3 — CID 70718090
3,6-dimethyl-N-(1,4-oxazepan-6-ylmethyl)-1-benzofuran-2-carboxamide (PubChem CID 70718090) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3,6-dimethyl-N-(1,4-oxazepan-6-ylmethyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3,6-dimethyl-N-(1,4-oxazepan-6-ylmethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 70718090 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3,6-dimethyl-N-(1,4-oxazepan-6-ylmethyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2c(C)c(C(=O)NCC3CNCCOC3)oc2c1 |
| InChI | InChI=1S/C17H22N2O3/c1-11-3-4-14-12(2)16(22-15(14)7-11)17(20)19-9-13-8-18-5-6-21-10-13/h3-4,7,13,18H,5-6,8-10H2,1-2H3,(H,19,20) |
| InChIKey | BMERDEIJJRIMNW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |