C52H42B2N2O4 — CID 159683366
CID 159683366 (PubChem CID 159683366) has the molecular formula C52H42B2N2O4 and a molecular weight of 780.54 g/mol.
| Compound Name | CID 159683366 |
|---|---|
| PubChem CID | 159683366 |
| Molecular Formula | C52H42B2N2O4 |
| Molecular Weight | 780.54 g/mol |
| Exact Mass | 780.33 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccccc3)c3ccc(O[B]O)cc3)cc21.O[B]Oc1ccc2c(c1)Cc1cc(N(c3ccccc3)c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C27H23BNO2.C25H19BNO2/c1-27(2)25-11-7-6-10-23(25)24-17-14-21(18-26(24)27)29(19-8-4-3-5-9-19)20-12-15-22(16-13-20)31-28-30;28-26-29-23-12-14-25-19(17-23)15-18-16-22(11-13-24(18)25)27(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h3-18,30H,1-2H3;1-14,16-17,28H,15H2 |
| InChIKey | LMQPOOUKDZNHCM-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.54 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|