C21H25N3O6S — CID 159683971
methane;N-methyl-1-[1-(4-methylphenyl)sulfonyl-2-phenylimidazol-4-yl]methanamine;oxalic acid (PubChem CID 159683971) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is methane;N-methyl-1-[1-(4-methylphenyl)sulfonyl-2-phenylimidazol-4-yl]methanamine;oxalic acid.
| Compound Name | methane;N-methyl-1-[1-(4-methylphenyl)sulfonyl-2-phenylimidazol-4-yl]methanamine;oxalic acid |
|---|---|
| PubChem CID | 159683971 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | methane;N-methyl-1-[1-(4-methylphenyl)sulfonyl-2-phenylimidazol-4-yl]methanamine;oxalic acid |
| SMILES | C.CNCc1cn(S(=O)(=O)c2ccc(C)cc2)c(-c2ccccc2)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H19N3O2S.C2H2O4.CH4/c1-14-8-10-17(11-9-14)24(22,23)21-13-16(12-19-2)20-18(21)15-6-4-3-5-7-15;3-1(4)2(5)6;/h3-11,13,19H,12H2,1-2H3;(H,3,4)(H,5,6);1H4 |
| InChIKey | WGUBFZHVXMCQII-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|