C34H49NO — CID 159686048
ethylcyclohexane;2-ethylnaphthalene;N-methyl-N-pentyl-2-phenylacetamide (PubChem CID 159686048) has the molecular formula C34H49NO and a molecular weight of 487.77 g/mol. Its IUPAC name is ethylcyclohexane;2-ethylnaphthalene;N-methyl-N-pentyl-2-phenylacetamide.
| Compound Name | ethylcyclohexane;2-ethylnaphthalene;N-methyl-N-pentyl-2-phenylacetamide |
|---|---|
| PubChem CID | 159686048 |
| Molecular Formula | C34H49NO |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.38 |
| IUPAC Name | ethylcyclohexane;2-ethylnaphthalene;N-methyl-N-pentyl-2-phenylacetamide |
| SMILES | CCC1CCCCC1.CCCCCN(C)C(=O)Cc1ccccc1.CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H21NO.C12H12.C8H16/c1-3-4-8-11-15(2)14(16)12-13-9-6-5-7-10-13;1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-2-8-6-4-3-5-7-8/h5-7,9-10H,3-4,8,11-12H2,1-2H3;3-9H,2H2,1H3;8H,2-7H2,1H3 |
| InChIKey | MVUURHNKPIUGRD-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|