C33H47NO — CID 158688887
2-ethylnaphthalene;methylcyclohexane;N-methyl-N-pentyl-2-phenylacetamide (PubChem CID 158688887) has the molecular formula C33H47NO and a molecular weight of 473.75 g/mol. Its IUPAC name is 2-ethylnaphthalene;methylcyclohexane;N-methyl-N-pentyl-2-phenylacetamide.
| Compound Name | 2-ethylnaphthalene;methylcyclohexane;N-methyl-N-pentyl-2-phenylacetamide |
|---|---|
| PubChem CID | 158688887 |
| Molecular Formula | C33H47NO |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 473.37 |
| IUPAC Name | 2-ethylnaphthalene;methylcyclohexane;N-methyl-N-pentyl-2-phenylacetamide |
| SMILES | CC1CCCCC1.CCCCCN(C)C(=O)Cc1ccccc1.CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H21NO.C12H12.C7H14/c1-3-4-8-11-15(2)14(16)12-13-9-6-5-7-10-13;1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-7-5-3-2-4-6-7/h5-7,9-10H,3-4,8,11-12H2,1-2H3;3-9H,2H2,1H3;7H,2-6H2,1H3 |
| InChIKey | IGBYMLTWSPDRAM-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|