C34H43N3O6S2 — CID 159688022
[2-[[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]-3-oxopropyl]disulfanyl]-2-methylpropyl] 2-[(1S)-3-methylidenecyclopentyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 159688022) has the molecular formula C34H43N3O6S2 and a molecular weight of 653.87 g/mol. Its IUPAC name is [2-[[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]-3-oxopropyl]disulfanyl]-2-methylpropyl] 2-[(1S)-3-methylidenecyclopentyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | [2-[[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]-3-oxopropyl]disulfanyl]-2-methylpropyl] 2-[(1S)-3-methylidenecyclopentyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 159688022 |
| Molecular Formula | C34H43N3O6S2 |
| Molecular Weight | 653.87 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | [2-[[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]-3-oxopropyl]disulfanyl]-2-methylpropyl] 2-[(1S)-3-methylidenecyclopentyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C1CC[C@H](C2OCCN2C(=O)OCC(C)(C)SSCCC(=O)NCCNC(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C34H43N3O6S2/c1-23-12-13-24(20-23)31-37(17-18-41-31)33(40)43-22-34(2,3)45-44-19-14-30(38)35-15-16-36-32(39)42-21-29-27-10-6-4-8-25(27)26-9-5-7-11-28(26)29/h4-11,24,29,31H,1,12-22H2,2-3H3,(H,35,38)(H,36,39)/t24-,31?/m0/s1 |
| InChIKey | IBSVMWXKFDLUIP-ACXKHFGCSA-N |
| XLogP | 6.34 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.87 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|