About methyl N-(3,4-dichlorophenyl)carbamate
methyl N-(3,4-dichlorophenyl)carbamate (PubChem CID 15969) has the molecular formula C8H7Cl2NO2
and a molecular weight of 220.06 g/mol. Its IUPAC name is methyl N-(3,4-dichlorophenyl)carbamate.
Molecular Properties
| Compound Name | methyl N-(3,4-dichlorophenyl)carbamate |
| PubChem CID | 15969 |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | methyl N-(3,4-dichlorophenyl)carbamate |
| SMILES | COC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2NO2/c1-13-8(12)11-5-2-3-6(9)7(10)4-5/h2-4H,1H3,(H,11,12) |
| InChIKey | WOZQBERUBLYCEG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl N-(3,4-dichlorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(3,4-dichlorophenyl)carbamate?
The IUPAC name of methyl N-(3,4-dichlorophenyl)carbamate (CID 15969) is methyl N-(3,4-dichlorophenyl)carbamate.
What is the SMILES notation for methyl N-(3,4-dichlorophenyl)carbamate?
The canonical SMILES for methyl N-(3,4-dichlorophenyl)carbamate is COC(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl N-(3,4-dichlorophenyl)carbamate?
The InChIKey is WOZQBERUBLYCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2NO2/c1-13-8(12)11-5-2-3-6(9)7(10)4-5/h2-4H,1H3,(H,11,12).
What are the key properties of methyl N-(3,4-dichlorophenyl)carbamate?
methyl N-(3,4-dichlorophenyl)carbamate has a molecular weight of 220.06 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3,4-dichlorophenyl)carbamate is sourced from PubChem (CID 15969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).