About 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane
4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane (PubChem CID 159691035) has the molecular formula C18H29N3O4
and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane.
Molecular Properties
| Compound Name | 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane |
| PubChem CID | 159691035 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane |
| SMILES | C.CC(=O)OCc1ccccc1.CNC(=O)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C9H10O2.C8H15N3O2.CH4/c1-8(10)11-7-9-5-3-2-4-6-9;1-7(12)10-3-5-11(6-4-10)8(13)9-2;/h2-6H,7H2,1H3;3-6H2,1-2H3,(H,9,13);1H4 |
| InChIKey | MWKKLLQTNOOHOK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane?
The IUPAC name of 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane (CID 159691035) is 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane.
What is the SMILES notation for 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane?
The canonical SMILES for 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane is C.CC(=O)OCc1ccccc1.CNC(=O)N1CCN(C(C)=O)CC1.
What is the InChIKey of 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane?
The InChIKey is MWKKLLQTNOOHOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C8H15N3O2.CH4/c1-8(10)11-7-9-5-3-2-4-6-9;1-7(12)10-3-5-11(6-4-10)8(13)9-2;/h2-6H,7H2,1H3;3-6H2,1-2H3,(H,9,13);1H4.
What are the key properties of 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane?
4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane has a molecular weight of 351.45 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-methylpiperazine-1-carboxamide;benzyl acetate;methane is sourced from PubChem (CID 159691035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).