C20H23BrClN3O3S — CID 159695313
1-(2-bromo-4-methoxyphenyl)sulfonyl-3-(chloromethyl)indole;piperazine (PubChem CID 159695313) has the molecular formula C20H23BrClN3O3S and a molecular weight of 500.85 g/mol. Its IUPAC name is 1-(2-bromo-4-methoxyphenyl)sulfonyl-3-(chloromethyl)indole;piperazine.
| Compound Name | 1-(2-bromo-4-methoxyphenyl)sulfonyl-3-(chloromethyl)indole;piperazine |
|---|---|
| PubChem CID | 159695313 |
| Molecular Formula | C20H23BrClN3O3S |
| Molecular Weight | 500.85 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | 1-(2-bromo-4-methoxyphenyl)sulfonyl-3-(chloromethyl)indole;piperazine |
| SMILES | C1CNCCN1.COc1ccc(S(=O)(=O)n2cc(CCl)c3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C16H13BrClNO3S.C4H10N2/c1-22-12-6-7-16(14(17)8-12)23(20,21)19-10-11(9-18)13-4-2-3-5-15(13)19;1-2-6-4-3-5-1/h2-8,10H,9H2,1H3;5-6H,1-4H2 |
| InChIKey | MWXXEJXSPUUSFF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|