C25H25BrN4O3S — CID 10459958
1-(2-bromo-4-methoxyphenyl)sulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole (PubChem CID 10459958) has the molecular formula C25H25BrN4O3S and a molecular weight of 541.47 g/mol. Its IUPAC name is 1-(2-bromo-4-methoxyphenyl)sulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole.
| Compound Name | 1-(2-bromo-4-methoxyphenyl)sulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole |
|---|---|
| PubChem CID | 10459958 |
| Molecular Formula | C25H25BrN4O3S |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 1-(2-bromo-4-methoxyphenyl)sulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole |
| SMILES | COc1ccc(S(=O)(=O)n2cc(CN3CCN(c4ccccn4)CC3)c3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C25H25BrN4O3S/c1-33-20-9-10-24(22(26)16-20)34(31,32)30-18-19(21-6-2-3-7-23(21)30)17-28-12-14-29(15-13-28)25-8-4-5-11-27-25/h2-11,16,18H,12-15,17H2,1H3 |
| InChIKey | JCBJMRJGUSQZOZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |