C16H15BrN2O3S — CID 25118042
[1-(4-bromo-2-methoxyphenyl)sulfonylindol-3-yl]methanamine (PubChem CID 25118042) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is [1-(4-bromo-2-methoxyphenyl)sulfonylindol-3-yl]methanamine.
| Compound Name | [1-(4-bromo-2-methoxyphenyl)sulfonylindol-3-yl]methanamine |
|---|---|
| PubChem CID | 25118042 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | [1-(4-bromo-2-methoxyphenyl)sulfonylindol-3-yl]methanamine |
| SMILES | COc1cc(Br)ccc1S(=O)(=O)n1cc(CN)c2ccccc21 |
| InChI | InChI=1S/C16H15BrN2O3S/c1-22-15-8-12(17)6-7-16(15)23(20,21)19-10-11(9-18)13-4-2-3-5-14(13)19/h2-8,10H,9,18H2,1H3 |
| InChIKey | OEWAIWTUADHGOZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |