C27H28BrFN4O2S — CID 174495725
5-bromo-1-prop-2-enylsulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole;fluorobenzene (PubChem CID 174495725) has the molecular formula C27H28BrFN4O2S and a molecular weight of 571.52 g/mol. Its IUPAC name is 5-bromo-1-prop-2-enylsulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole;fluorobenzene.
| Compound Name | 5-bromo-1-prop-2-enylsulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole;fluorobenzene |
|---|---|
| PubChem CID | 174495725 |
| Molecular Formula | C27H28BrFN4O2S |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 5-bromo-1-prop-2-enylsulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]indole;fluorobenzene |
| SMILES | C=CCS(=O)(=O)n1cc(CN2CCN(c3ccccn3)CC2)c2cc(Br)ccc21.Fc1ccccc1 |
| InChI | InChI=1S/C21H23BrN4O2S.C6H5F/c1-2-13-29(27,28)26-16-17(19-14-18(22)6-7-20(19)26)15-24-9-11-25(12-10-24)21-5-3-4-8-23-21;7-6-4-2-1-3-5-6/h2-8,14,16H,1,9-13,15H2;1-5H |
| InChIKey | XCNSDSUJIKJFBT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|