C30H36N4O2S — CID 174700903
cumene;5-prop-2-enylsulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-indole (PubChem CID 174700903) has the molecular formula C30H36N4O2S and a molecular weight of 516.71 g/mol. Its IUPAC name is cumene;5-prop-2-enylsulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-indole.
| Compound Name | cumene;5-prop-2-enylsulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 174700903 |
| Molecular Formula | C30H36N4O2S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | cumene;5-prop-2-enylsulfonyl-3-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-indole |
| SMILES | C=CCS(=O)(=O)c1ccc2[nH]cc(CN3CCN(c4ccccn4)CC3)c2c1.CC(C)c1ccccc1 |
| InChI | InChI=1S/C21H24N4O2S.C9H12/c1-2-13-28(26,27)18-6-7-20-19(14-18)17(15-23-20)16-24-9-11-25(12-10-24)21-5-3-4-8-22-21;1-8(2)9-6-4-3-5-7-9/h2-8,14-15,23H,1,9-13,16H2;3-8H,1-2H3 |
| InChIKey | GEJQWYXVNTUWHN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|