C29H36FN3O9S — CID 174700858
fluorobenzene;2-hydroxypropane-1,2,3-tricarboxylic acid;3-[(4-methylpiperazin-1-yl)methyl]-5-prop-2-enylsulfonyl-1H-indole (PubChem CID 174700858) has the molecular formula C29H36FN3O9S and a molecular weight of 621.68 g/mol. Its IUPAC name is fluorobenzene;2-hydroxypropane-1,2,3-tricarboxylic acid;3-[(4-methylpiperazin-1-yl)methyl]-5-prop-2-enylsulfonyl-1H-indole.
| Compound Name | fluorobenzene;2-hydroxypropane-1,2,3-tricarboxylic acid;3-[(4-methylpiperazin-1-yl)methyl]-5-prop-2-enylsulfonyl-1H-indole |
|---|---|
| PubChem CID | 174700858 |
| Molecular Formula | C29H36FN3O9S |
| Molecular Weight | 621.68 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | fluorobenzene;2-hydroxypropane-1,2,3-tricarboxylic acid;3-[(4-methylpiperazin-1-yl)methyl]-5-prop-2-enylsulfonyl-1H-indole |
| SMILES | C=CCS(=O)(=O)c1ccc2[nH]cc(CN3CCN(C)CC3)c2c1.Fc1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H23N3O2S.C6H5F.C6H8O7/c1-3-10-23(21,22)15-4-5-17-16(11-15)14(12-18-17)13-20-8-6-19(2)7-9-20;7-6-4-2-1-3-5-6;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-5,11-12,18H,1,6-10,13H2,2H3;1-5H;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | YMCPBEXDRFXCCR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 188.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.68 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|