C20H23ClN4 — CID 159696108
6-chloro-4-propan-2-yl-1H-pyrrolo[2,3-b]pyridine;4-propan-2-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 159696108) has the molecular formula C20H23ClN4 and a molecular weight of 354.88 g/mol. Its IUPAC name is 6-chloro-4-propan-2-yl-1H-pyrrolo[2,3-b]pyridine;4-propan-2-yl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 6-chloro-4-propan-2-yl-1H-pyrrolo[2,3-b]pyridine;4-propan-2-yl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 159696108 |
| Molecular Formula | C20H23ClN4 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 6-chloro-4-propan-2-yl-1H-pyrrolo[2,3-b]pyridine;4-propan-2-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC(C)c1cc(Cl)nc2[nH]ccc12.CC(C)c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C10H11ClN2.C10H12N2/c1-6(2)8-5-9(11)13-10-7(8)3-4-12-10;1-7(2)8-3-5-11-10-9(8)4-6-12-10/h3-6H,1-2H3,(H,12,13);3-7H,1-2H3,(H,11,12) |
| InChIKey | MXAKLZQAFPWBIK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|