C20H25N7O — CID 159698682
1-[2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-4-pyridinyl]pent-4-yn-1-one (PubChem CID 159698682) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 1-[2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-4-pyridinyl]pent-4-yn-1-one.
| Compound Name | 1-[2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-4-pyridinyl]pent-4-yn-1-one |
|---|---|
| PubChem CID | 159698682 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-4-pyridinyl]pent-4-yn-1-one |
| SMILES | C#CCCC(=O)c1ccnc(Nc2nc(CC)nc(N3CCN(C)CC3)n2)c1 |
| InChI | InChI=1S/C20H25N7O/c1-4-6-7-16(28)15-8-9-21-18(14-15)23-19-22-17(5-2)24-20(25-19)27-12-10-26(3)11-13-27/h1,8-9,14H,5-7,10-13H2,2-3H3,(H,21,22,23,24,25) |
| InChIKey | ILGDTFNFCSEMPH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|