C23H35N7O — CID 161152258
1-[2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-4-pyridinyl]octan-1-one (PubChem CID 161152258) has the molecular formula C23H35N7O and a molecular weight of 425.58 g/mol. Its IUPAC name is 1-[2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-4-pyridinyl]octan-1-one.
| Compound Name | 1-[2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-4-pyridinyl]octan-1-one |
|---|---|
| PubChem CID | 161152258 |
| Molecular Formula | C23H35N7O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 1-[2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-4-pyridinyl]octan-1-one |
| SMILES | CCCCCCCC(=O)c1ccnc(Nc2nc(CC)nc(N3CCN(C)CC3)n2)c1 |
| InChI | InChI=1S/C23H35N7O/c1-4-6-7-8-9-10-19(31)18-11-12-24-21(17-18)26-22-25-20(5-2)27-23(28-22)30-15-13-29(3)14-16-30/h11-12,17H,4-10,13-16H2,1-3H3,(H,24,25,26,27,28) |
| InChIKey | IYDIWQUVAYOYNR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|