C19H26N8O — CID 88995125
2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-N-prop-2-enylpyridine-4-carboxamide (PubChem CID 88995125) has the molecular formula C19H26N8O and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-N-prop-2-enylpyridine-4-carboxamide.
| Compound Name | 2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-N-prop-2-enylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 88995125 |
| Molecular Formula | C19H26N8O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 2-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-N-prop-2-enylpyridine-4-carboxamide |
| SMILES | C=CCNC(=O)c1ccnc(Nc2nc(CC)nc(N3CCN(C)CC3)n2)c1 |
| InChI | InChI=1S/C19H26N8O/c1-4-7-21-17(28)14-6-8-20-16(13-14)23-18-22-15(5-2)24-19(25-18)27-11-9-26(3)10-12-27/h4,6,8,13H,1,5,7,9-12H2,2-3H3,(H,21,28)(H,20,22,23,24,25) |
| InChIKey | DGTRSJXARPYZRO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|