C18H25N9O — CID 88994960
6-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-N-prop-2-enylpyridazine-3-carboxamide (PubChem CID 88994960) has the molecular formula C18H25N9O and a molecular weight of 383.46 g/mol. Its IUPAC name is 6-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-N-prop-2-enylpyridazine-3-carboxamide.
| Compound Name | 6-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-N-prop-2-enylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 88994960 |
| Molecular Formula | C18H25N9O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 6-[[4-ethyl-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-N-prop-2-enylpyridazine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(Nc2nc(CC)nc(N3CCN(C)CC3)n2)nn1 |
| InChI | InChI=1S/C18H25N9O/c1-4-8-19-16(28)13-6-7-15(25-24-13)21-17-20-14(5-2)22-18(23-17)27-11-9-26(3)10-12-27/h4,6-7H,1,5,8-12H2,2-3H3,(H,19,28)(H,20,21,22,23,25) |
| InChIKey | PTQWJLFUYJNMOK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|