C24H24N10O5 — CID 159702137
ethyl 5-[(7H-purin-6-ylamino)methyl]furan-2-carboxylate;[5-[(7H-purin-6-ylamino)methyl]furan-2-yl]methanol (PubChem CID 159702137) has the molecular formula C24H24N10O5 and a molecular weight of 532.52 g/mol. Its IUPAC name is ethyl 5-[(7H-purin-6-ylamino)methyl]furan-2-carboxylate;[5-[(7H-purin-6-ylamino)methyl]furan-2-yl]methanol.
| Compound Name | ethyl 5-[(7H-purin-6-ylamino)methyl]furan-2-carboxylate;[5-[(7H-purin-6-ylamino)methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 159702137 |
| Molecular Formula | C24H24N10O5 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | ethyl 5-[(7H-purin-6-ylamino)methyl]furan-2-carboxylate;[5-[(7H-purin-6-ylamino)methyl]furan-2-yl]methanol |
| SMILES | CCOC(=O)c1ccc(CNc2ncnc3nc[nH]c23)o1.OCc1ccc(CNc2ncnc3nc[nH]c23)o1 |
| InChI | InChI=1S/C13H13N5O3.C11H11N5O2/c1-2-20-13(19)9-4-3-8(21-9)5-14-11-10-12(16-6-15-10)18-7-17-11;17-4-8-2-1-7(18-8)3-12-10-9-11(14-5-13-9)16-6-15-10/h3-4,6-7H,2,5H2,1H3,(H2,14,15,16,17,18);1-2,5-6,17H,3-4H2,(H2,12,13,14,15,16) |
| InChIKey | MXTIFEQDKXTXKO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 205.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |