C25H29F3N2O2S2 — CID 159702323
1-[(5R,7S)-5,7-dimethyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one (PubChem CID 159702323) has the molecular formula C25H29F3N2O2S2 and a molecular weight of 510.65 g/mol. Its IUPAC name is 1-[(5R,7S)-5,7-dimethyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one.
| Compound Name | 1-[(5R,7S)-5,7-dimethyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one |
|---|---|
| PubChem CID | 159702323 |
| Molecular Formula | C25H29F3N2O2S2 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1-[(5R,7S)-5,7-dimethyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one |
| SMILES | COCCCCCC(=O)Cc1sc2c(c1-c1nc3cc(C(F)(F)F)ccc3s1)C[C@@H](C)N[C@H]2C |
| InChI | InChI=1S/C25H29F3N2O2S2/c1-14-11-18-22(24-30-19-12-16(25(26,27)28)8-9-20(19)34-24)21(33-23(18)15(2)29-14)13-17(31)7-5-4-6-10-32-3/h8-9,12,14-15,29H,4-7,10-11,13H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | JEMVJMAJWPRVMC-CABCVRRESA-N |
| XLogP | 6.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|