C10H10O2 — CID 159702482
(5S)-4,5-dimethylocta-1,7-diyne-3,6-dione (PubChem CID 159702482) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (5S)-4,5-dimethylocta-1,7-diyne-3,6-dione.
| Compound Name | (5S)-4,5-dimethylocta-1,7-diyne-3,6-dione |
|---|---|
| PubChem CID | 159702482 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (5S)-4,5-dimethylocta-1,7-diyne-3,6-dione |
| SMILES | C#CC(=O)C(C)[C@H](C)C(=O)C#C |
| InChI | InChI=1S/C10H10O2/c1-5-9(11)7(3)8(4)10(12)6-2/h1-2,7-8H,3-4H3/t7-,8?/m0/s1 |
| InChIKey | UXVUUFXURDNMQL-JAMMHHFISA-N |
| XLogP | 0.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|