About benzene;neodymium;phenylphosphonic acid
benzene;neodymium;phenylphosphonic acid (PubChem CID 159714726) has the molecular formula C12H12NdO3P-
and a molecular weight of 379.44 g/mol. Its IUPAC name is benzene;neodymium;phenylphosphonic acid.
Molecular Properties
| Compound Name | benzene;neodymium;phenylphosphonic acid |
| PubChem CID | 159714726 |
| Molecular Formula | C12H12NdO3P- |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | benzene;neodymium;phenylphosphonic acid |
| SMILES | O=P(O)(O)c1ccccc1.[Nd].[c-]1ccccc1 |
| InChI | InChI=1S/C6H7O3P.C6H5.Nd/c7-10(8,9)6-4-2-1-3-5-6;1-2-4-6-5-3-1;/h1-5H,(H2,7,8,9);1-5H;/q;-1; |
| InChIKey | BOIKLTRHCTVFNH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene;neodymium;phenylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;neodymium;phenylphosphonic acid?
The IUPAC name of benzene;neodymium;phenylphosphonic acid (CID 159714726) is benzene;neodymium;phenylphosphonic acid.
What is the SMILES notation for benzene;neodymium;phenylphosphonic acid?
The canonical SMILES for benzene;neodymium;phenylphosphonic acid is O=P(O)(O)c1ccccc1.[Nd].[c-]1ccccc1.
What is the InChIKey of benzene;neodymium;phenylphosphonic acid?
The InChIKey is BOIKLTRHCTVFNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7O3P.C6H5.Nd/c7-10(8,9)6-4-2-1-3-5-6;1-2-4-6-5-3-1;/h1-5H,(H2,7,8,9);1-5H;/q;-1;.
What are the key properties of benzene;neodymium;phenylphosphonic acid?
benzene;neodymium;phenylphosphonic acid has a molecular weight of 379.44 g/mol, XLogP of 1.98, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;neodymium;phenylphosphonic acid is sourced from PubChem (CID 159714726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).