C22H26N2O5S — CID 159717935
propan-2-yl 5-[1-benzofuran-5-ylsulfonyl(pyridin-4-ylmethyl)amino]pentanoate (PubChem CID 159717935) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is propan-2-yl 5-[1-benzofuran-5-ylsulfonyl(pyridin-4-ylmethyl)amino]pentanoate.
| Compound Name | propan-2-yl 5-[1-benzofuran-5-ylsulfonyl(pyridin-4-ylmethyl)amino]pentanoate |
|---|---|
| PubChem CID | 159717935 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | propan-2-yl 5-[1-benzofuran-5-ylsulfonyl(pyridin-4-ylmethyl)amino]pentanoate |
| SMILES | CC(C)OC(=O)CCCCN(Cc1ccncc1)S(=O)(=O)c1ccc2occc2c1 |
| InChI | InChI=1S/C22H26N2O5S/c1-17(2)29-22(25)5-3-4-13-24(16-18-8-11-23-12-9-18)30(26,27)20-6-7-21-19(15-20)10-14-28-21/h6-12,14-15,17H,3-5,13,16H2,1-2H3 |
| InChIKey | PUKOHNLCOHSFOK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|