About 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran
5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran (PubChem CID 159719962) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 159719962 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran |
| SMILES | COCc1c(C)cc2c(c1C)CCO2 |
| InChI | InChI=1S/C12H16O2/c1-8-6-12-10(4-5-14-12)9(2)11(8)7-13-3/h6H,4-5,7H2,1-3H3 |
| InChIKey | MZXHBRBYTNHETA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran?
The IUPAC name of 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran (CID 159719962) is 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran is COCc1c(C)cc2c(c1C)CCO2.
What is the InChIKey of 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran?
The InChIKey is MZXHBRBYTNHETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-8-6-12-10(4-5-14-12)9(2)11(8)7-13-3/h6H,4-5,7H2,1-3H3.
What are the key properties of 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran?
5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran has a molecular weight of 192.26 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-4,6-dimethyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 159719962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).