About 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate
2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate (PubChem CID 159725967) has the molecular formula C14H24O5
and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate.
Molecular Properties
| Compound Name | 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate |
| PubChem CID | 159725967 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate |
| SMILES | C=CC(CC)OC(C)=O.CCC(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C7H12O3.C7H12O2/c1-4-7(5(2)8)10-6(3)9;1-4-7(5-2)9-6(3)8/h7H,4H2,1-3H3;4,7H,1,5H2,2-3H3 |
| InChIKey | NAQDHMMHYPCFIT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate?
The IUPAC name of 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate (CID 159725967) is 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate.
What is the SMILES notation for 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate?
The canonical SMILES for 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate is C=CC(CC)OC(C)=O.CCC(OC(C)=O)C(C)=O.
What is the InChIKey of 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate?
The InChIKey is NAQDHMMHYPCFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C7H12O2/c1-4-7(5(2)8)10-6(3)9;1-4-7(5-2)9-6(3)8/h7H,4H2,1-3H3;4,7H,1,5H2,2-3H3.
What are the key properties of 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate?
2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate has a molecular weight of 272.34 g/mol, XLogP of 2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopentan-3-yl acetate;pent-1-en-3-yl acetate is sourced from PubChem (CID 159725967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).