C27H26N2O4 — CID 159726035
7-[(3R)-3-hydroxypiperidine-1-carbonyl]-3-(3-methoxyphenyl)-9H-fluorene-1-carboxamide (PubChem CID 159726035) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 7-[(3R)-3-hydroxypiperidine-1-carbonyl]-3-(3-methoxyphenyl)-9H-fluorene-1-carboxamide.
| Compound Name | 7-[(3R)-3-hydroxypiperidine-1-carbonyl]-3-(3-methoxyphenyl)-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 159726035 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 7-[(3R)-3-hydroxypiperidine-1-carbonyl]-3-(3-methoxyphenyl)-9H-fluorene-1-carboxamide |
| SMILES | COc1cccc(-c2cc(C(N)=O)c3c(c2)-c2ccc(C(=O)N4CCC[C@@H](O)C4)cc2C3)c1 |
| InChI | InChI=1S/C27H26N2O4/c1-33-21-6-2-4-16(11-21)18-12-23-22-8-7-17(27(32)29-9-3-5-20(30)15-29)10-19(22)14-24(23)25(13-18)26(28)31/h2,4,6-8,10-13,20,30H,3,5,9,14-15H2,1H3,(H2,28,31)/t20-/m1/s1 |
| InChIKey | NAQKQKNIDPDHSH-HXUWFJFHSA-N |
| XLogP | 3.63 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |