C28H23N3O3 — CID 160601958
3-(3-methoxyphenyl)-7-N-(pyridin-2-ylmethyl)-9H-fluorene-1,7-dicarboxamide (PubChem CID 160601958) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-7-N-(pyridin-2-ylmethyl)-9H-fluorene-1,7-dicarboxamide.
| Compound Name | 3-(3-methoxyphenyl)-7-N-(pyridin-2-ylmethyl)-9H-fluorene-1,7-dicarboxamide |
|---|---|
| PubChem CID | 160601958 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-(3-methoxyphenyl)-7-N-(pyridin-2-ylmethyl)-9H-fluorene-1,7-dicarboxamide |
| SMILES | COc1cccc(-c2cc(C(N)=O)c3c(c2)-c2ccc(C(=O)NCc4ccccn4)cc2C3)c1 |
| InChI | InChI=1S/C28H23N3O3/c1-34-22-7-4-5-17(12-22)19-13-24-23-9-8-18(28(33)31-16-21-6-2-3-10-30-21)11-20(23)15-25(24)26(14-19)27(29)32/h2-14H,15-16H2,1H3,(H2,29,32)(H,31,33) |
| InChIKey | REJSYPPQKGCJBL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |