C20H16N2O2 — CID 160526281
8-(3-methoxyphenyl)-5H-indeno[1,2-b]pyridine-6-carboxamide (PubChem CID 160526281) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 8-(3-methoxyphenyl)-5H-indeno[1,2-b]pyridine-6-carboxamide.
| Compound Name | 8-(3-methoxyphenyl)-5H-indeno[1,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 160526281 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 8-(3-methoxyphenyl)-5H-indeno[1,2-b]pyridine-6-carboxamide |
| SMILES | COc1cccc(-c2cc(C(N)=O)c3c(c2)-c2ncccc2C3)c1 |
| InChI | InChI=1S/C20H16N2O2/c1-24-15-6-2-4-12(8-15)14-10-17-16(18(11-14)20(21)23)9-13-5-3-7-22-19(13)17/h2-8,10-11H,9H2,1H3,(H2,21,23) |
| InChIKey | QUXYCYXTUMGQFR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |