C28H29NO6 — CID 158776823
2-(2-methoxyethoxy)ethyl 2-[8-carbamoyl-6-(3-methoxyphenyl)-9H-fluoren-2-yl]acetate (PubChem CID 158776823) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 2-[8-carbamoyl-6-(3-methoxyphenyl)-9H-fluoren-2-yl]acetate.
| Compound Name | 2-(2-methoxyethoxy)ethyl 2-[8-carbamoyl-6-(3-methoxyphenyl)-9H-fluoren-2-yl]acetate |
|---|---|
| PubChem CID | 158776823 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 2-[8-carbamoyl-6-(3-methoxyphenyl)-9H-fluoren-2-yl]acetate |
| SMILES | COCCOCCOC(=O)Cc1ccc2c(c1)Cc1c(C(N)=O)cc(-c3cccc(OC)c3)cc1-2 |
| InChI | InChI=1S/C28H29NO6/c1-32-8-9-34-10-11-35-27(30)13-18-6-7-23-21(12-18)17-25-24(23)15-20(16-26(25)28(29)31)19-4-3-5-22(14-19)33-2/h3-7,12,14-16H,8-11,13,17H2,1-2H3,(H2,29,31) |
| InChIKey | IQOMXKFSVFHFJO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|