C18H48O13Si8 — CID 159735415
methoxyethane;3-(1,3,9,11,16-pentaethyl-13-methyl-2,4,6,8,10,12,15,17,18,19,20-undecaoxa-1,3,5,7,9,11,13,16-octasilatetracyclo[9.6.1.13,9.15,16]icosan-5-yl)propan-1-ol (PubChem CID 159735415) has the molecular formula C18H48O13Si8 and a molecular weight of 697.26 g/mol. Its IUPAC name is methoxyethane;3-(1,3,9,11,16-pentaethyl-13-methyl-2,4,6,8,10,12,15,17,18,19,20-undecaoxa-1,3,5,7,9,11,13,16-octasilatetracyclo[9.6.1.13,9.15,16]icosan-5-yl)propan-1-ol.
| Compound Name | methoxyethane;3-(1,3,9,11,16-pentaethyl-13-methyl-2,4,6,8,10,12,15,17,18,19,20-undecaoxa-1,3,5,7,9,11,13,16-octasilatetracyclo[9.6.1.13,9.15,16]icosan-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 159735415 |
| Molecular Formula | C18H48O13Si8 |
| Molecular Weight | 697.26 g/mol |
| Exact Mass | 696.12 |
| IUPAC Name | methoxyethane;3-(1,3,9,11,16-pentaethyl-13-methyl-2,4,6,8,10,12,15,17,18,19,20-undecaoxa-1,3,5,7,9,11,13,16-octasilatetracyclo[9.6.1.13,9.15,16]icosan-5-yl)propan-1-ol |
| SMILES | CCOC.CC[Si]12OC[SiH](C)O[Si]3(CC)O[Si]4(CC)O[SiH2]O[Si](CCCO)(O1)O[Si](CC)(O4)O[Si](CC)(O2)O3 |
| InChI | InChI=1S/C15H40O12Si8.C3H8O/c1-7-30-17-15-29(6)20-32(9-3)23-31(8-2)18-28-19-35(22-30,14-12-13-16)27-34(11-5,24-31)26-33(10-4,21-30)25-32;1-3-4-2/h16,29H,7-15,28H2,1-6H3;3H2,1-2H3 |
| InChIKey | NBTUSVFHKCTBSL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|