C14H27ClN2 — CID 159739800
1-tert-butyl-6-(3-chloropropyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 159739800) has the molecular formula C14H27ClN2 and a molecular weight of 258.84 g/mol. Its IUPAC name is 1-tert-butyl-6-(3-chloropropyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | 1-tert-butyl-6-(3-chloropropyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 159739800 |
| Molecular Formula | C14H27ClN2 |
| Molecular Weight | 258.84 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 1-tert-butyl-6-(3-chloropropyl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | CC(C)(C)N1CCC2CCN(CCCCl)CC21 |
| InChI | InChI=1S/C14H27ClN2/c1-14(2,3)17-10-6-12-5-9-16(8-4-7-15)11-13(12)17/h12-13H,4-11H2,1-3H3 |
| InChIKey | NCHQFXFYAWVQDV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.84 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|