C20H36N4O4 — CID 159740354
3,9-dimethyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one (PubChem CID 159740354) has the molecular formula C20H36N4O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is 3,9-dimethyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one.
| Compound Name | 3,9-dimethyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 159740354 |
| Molecular Formula | C20H36N4O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 3,9-dimethyl-1-oxa-3,9-diazaspiro[5.5]undecan-2-one |
| SMILES | CN1CCC2(CC1)CCN(C)C(=O)O2.CN1CCC2(CC1)CCN(C)C(=O)O2 |
| InChI | InChI=1S/2C10H18N2O2/c2*1-11-6-3-10(4-7-11)5-8-12(2)9(13)14-10/h2*3-8H2,1-2H3 |
| InChIKey | NCJMBPQNEZXZNW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |