C11H20N6O4 — CID 159752510
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;5-methyl-1H-pyrimidine-2,4-dione (PubChem CID 159752510) has the molecular formula C11H20N6O4 and a molecular weight of 300.32 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;5-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;5-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159752510 |
| Molecular Formula | C11H20N6O4 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;5-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cc1c[nH]c(=O)[nH]c1=O.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C5H6N2O2/c7-4(5(11)12)2-1-3-10-6(8)9;1-3-2-6-5(9)7-4(3)8/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2H,1H3,(H2,6,7,8,9)/t4-;/m0./s1 |
| InChIKey | NDVCFHSWVRWIOH-WCCKRBBISA-N |
| XLogP | -2.18 |
| TPSA | 193.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|