About 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one
4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one (PubChem CID 159755596) has the molecular formula C19H17NO4
and a molecular weight of 323.35 g/mol. Its IUPAC name is 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one |
| PubChem CID | 159755596 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one |
| SMILES | Cc1ccc2c(=O)onc(C)c2c1.Cc1ccc2c(c1)COC2=O |
| InChI | InChI=1S/C10H9NO2.C9H8O2/c1-6-3-4-8-9(5-6)7(2)11-13-10(8)12;1-6-2-3-8-7(4-6)5-11-9(8)10/h3-5H,1-2H3;2-4H,5H2,1H3 |
| InChIKey | NEFHGTBQIDFKNU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one?
The IUPAC name of 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one (CID 159755596) is 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one.
What is the SMILES notation for 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one?
The canonical SMILES for 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one is Cc1ccc2c(=O)onc(C)c2c1.Cc1ccc2c(c1)COC2=O.
What is the InChIKey of 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one?
The InChIKey is NEFHGTBQIDFKNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.C9H8O2/c1-6-3-4-8-9(5-6)7(2)11-13-10(8)12;1-6-2-3-8-7(4-6)5-11-9(8)10/h3-5H,1-2H3;2-4H,5H2,1H3.
What are the key properties of 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one?
4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one has a molecular weight of 323.35 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2,3-benzoxazin-1-one;5-methyl-3H-2-benzofuran-1-one is sourced from PubChem (CID 159755596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).