C25H28N4O5S — CID 159757497
1-[5-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrazin-2-yl]-2-(oxan-2-yloxy)ethanone (PubChem CID 159757497) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is 1-[5-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrazin-2-yl]-2-(oxan-2-yloxy)ethanone.
| Compound Name | 1-[5-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrazin-2-yl]-2-(oxan-2-yloxy)ethanone |
|---|---|
| PubChem CID | 159757497 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 1-[5-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrazin-2-yl]-2-(oxan-2-yloxy)ethanone |
| SMILES | O=C(COC1CCCCO1)c1cnc(N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)cn1 |
| InChI | InChI=1S/C25H28N4O5S/c30-23(18-34-25-7-3-4-14-33-25)22-16-27-24(17-26-22)28-10-12-29(13-11-28)35(31,32)21-9-8-19-5-1-2-6-20(19)15-21/h1-2,5-6,8-9,15-17,25H,3-4,7,10-14,18H2 |
| InChIKey | NELLYYMSYQHEQY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |