About lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide
lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide (PubChem CID 159764028) has the molecular formula C17H24LiNO3
and a molecular weight of 297.32 g/mol. Its IUPAC name is lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide.
Molecular Properties
| Compound Name | lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide |
| PubChem CID | 159764028 |
| Molecular Formula | C17H24LiNO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide |
| SMILES | CC(C)[N-]C(C)C.O=C1CC(C(=O)c2ccccc2)CO1.[Li+] |
| InChI | InChI=1S/C11H10O3.C6H14N.Li/c12-10-6-9(7-14-10)11(13)8-4-2-1-3-5-8;1-5(2)7-6(3)4;/h1-5,9H,6-7H2;5-6H,1-4H3;/q;-1;+1 |
| InChIKey | NWRZAQQXANFWSD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 57.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide?
The IUPAC name of lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide (CID 159764028) is lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide.
What is the SMILES notation for lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide?
The canonical SMILES for lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide is CC(C)[N-]C(C)C.O=C1CC(C(=O)c2ccccc2)CO1.[Li+].
What is the InChIKey of lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide?
The InChIKey is NWRZAQQXANFWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3.C6H14N.Li/c12-10-6-9(7-14-10)11(13)8-4-2-1-3-5-8;1-5(2)7-6(3)4;/h1-5,9H,6-7H2;5-6H,1-4H3;/q;-1;+1.
What are the key properties of lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide?
lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide has a molecular weight of 297.32 g/mol, XLogP of 0.61, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;4-benzoyloxolan-2-one;di(propan-2-yl)azanide is sourced from PubChem (CID 159764028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).