About 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one
3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one (PubChem CID 159765875) has the molecular formula C21H29Br2NO
and a molecular weight of 471.28 g/mol. Its IUPAC name is 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one.
Molecular Properties
| Compound Name | 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one |
| PubChem CID | 159765875 |
| Molecular Formula | C21H29Br2NO |
| Molecular Weight | 471.28 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one |
| SMILES | CC(C)=O.Cc1c(Br)cccc1CC(C)C.Cc1c(N)cccc1Br |
| InChI | InChI=1S/C11H15Br.C7H8BrN.C3H6O/c1-8(2)7-10-5-4-6-11(12)9(10)3;1-5-6(8)3-2-4-7(5)9;1-3(2)4/h4-6,8H,7H2,1-3H3;2-4H,9H2,1H3;1-2H3 |
| InChIKey | NFMKKBOKUFGWLN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.28 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one?
The IUPAC name of 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one (CID 159765875) is 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one.
What is the SMILES notation for 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one?
The canonical SMILES for 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one is CC(C)=O.Cc1c(Br)cccc1CC(C)C.Cc1c(N)cccc1Br.
What is the InChIKey of 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one?
The InChIKey is NFMKKBOKUFGWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Br.C7H8BrN.C3H6O/c1-8(2)7-10-5-4-6-11(12)9(10)3;1-5-6(8)3-2-4-7(5)9;1-3(2)4/h4-6,8H,7H2,1-3H3;2-4H,9H2,1H3;1-2H3.
What are the key properties of 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one?
3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one has a molecular weight of 471.28 g/mol, XLogP of 6.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methylaniline;1-bromo-2-methyl-3-(2-methylpropyl)benzene;propan-2-one is sourced from PubChem (CID 159765875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).