C10H15NO2 — CID 174811459
3-(3-amino-2-methylphenyl)propane-1,2-diol (PubChem CID 174811459) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-(3-amino-2-methylphenyl)propane-1,2-diol.
| Compound Name | 3-(3-amino-2-methylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 174811459 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-(3-amino-2-methylphenyl)propane-1,2-diol |
| SMILES | Cc1c(N)cccc1CC(O)CO |
| InChI | InChI=1S/C10H15NO2/c1-7-8(5-9(13)6-12)3-2-4-10(7)11/h2-4,9,12-13H,5-6,11H2,1H3 |
| InChIKey | WJCYQNOVBNLRCR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|