C21H20N6O3S — CID 159766319
1-(5-isoquinolin-7-yl-1-methylpyrazol-3-yl)-3-[4-(methylaminosulfanyl)phenyl]urea;molecular oxygen (PubChem CID 159766319) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 1-(5-isoquinolin-7-yl-1-methylpyrazol-3-yl)-3-[4-(methylaminosulfanyl)phenyl]urea;molecular oxygen.
| Compound Name | 1-(5-isoquinolin-7-yl-1-methylpyrazol-3-yl)-3-[4-(methylaminosulfanyl)phenyl]urea;molecular oxygen |
|---|---|
| PubChem CID | 159766319 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1-(5-isoquinolin-7-yl-1-methylpyrazol-3-yl)-3-[4-(methylaminosulfanyl)phenyl]urea;molecular oxygen |
| SMILES | CNSc1ccc(NC(=O)Nc2cc(-c3ccc4ccncc4c3)n(C)n2)cc1.O=O |
| InChI | InChI=1S/C21H20N6OS.O2/c1-22-29-18-7-5-17(6-8-18)24-21(28)25-20-12-19(27(2)26-20)15-4-3-14-9-10-23-13-16(14)11-15;1-2/h3-13,22H,1-2H3,(H2,24,25,26,28); |
| InChIKey | NFNWNFQMWAVGQU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|